C12H15N3S2 — CID 62578414
N-(2-pyrimidin-2-ylsulfanylethyl)-2-thiophen-2-ylethanamine (PubChem CID 62578414) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is N-(2-pyrimidin-2-ylsulfanylethyl)-2-thiophen-2-ylethanamine.
| Compound Name | N-(2-pyrimidin-2-ylsulfanylethyl)-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 62578414 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | N-(2-pyrimidin-2-ylsulfanylethyl)-2-thiophen-2-ylethanamine |
| SMILES | c1cnc(SCCNCCc2cccs2)nc1 |
| InChI | InChI=1S/C12H15N3S2/c1-3-11(16-9-1)4-7-13-8-10-17-12-14-5-2-6-15-12/h1-3,5-6,9,13H,4,7-8,10H2 |
| InChIKey | DXVMOVUIRPBLFV-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|