C15H16N2S3 — CID 62578547
N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-2-thiophen-2-ylethanamine (PubChem CID 62578547) has the molecular formula C15H16N2S3 and a molecular weight of 320.51 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-2-thiophen-2-ylethanamine.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-2-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 62578547 |
| Molecular Formula | C15H16N2S3 |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylsulfanyl)ethyl]-2-thiophen-2-ylethanamine |
| SMILES | c1csc(CCNCCSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C15H16N2S3/c1-2-6-14-13(5-1)17-15(20-14)19-11-9-16-8-7-12-4-3-10-18-12/h1-6,10,16H,7-9,11H2 |
| InChIKey | YTKFNHBGDKTKGC-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|