C12H16ClN3S2 — CID 17123333
3-pyrimidin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine;hydrochloride (PubChem CID 17123333) has the molecular formula C12H16ClN3S2 and a molecular weight of 301.87 g/mol. Its IUPAC name is 3-pyrimidin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine;hydrochloride.
| Compound Name | 3-pyrimidin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17123333 |
| Molecular Formula | C12H16ClN3S2 |
| Molecular Weight | 301.87 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 3-pyrimidin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propan-1-amine;hydrochloride |
| SMILES | Cl.c1cnc(SCCCNCc2cccs2)nc1 |
| InChI | InChI=1S/C12H15N3S2.ClH/c1-4-11(16-8-1)10-13-5-3-9-17-12-14-6-2-7-15-12;/h1-2,4,6-8,13H,3,5,9-10H2;1H |
| InChIKey | HBASNVBANLRLNS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.87 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|