C13H22N2S — CID 142036010
N'-cyclopentyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 142036010) has the molecular formula C13H22N2S and a molecular weight of 238.40 g/mol. Its IUPAC name is N'-cyclopentyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-cyclopentyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 142036010 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N'-cyclopentyl-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | c1csc(CNCCCNC2CCCC2)c1 |
| InChI | InChI=1S/C13H22N2S/c1-2-6-12(5-1)15-9-4-8-14-11-13-7-3-10-16-13/h3,7,10,12,14-15H,1-2,4-6,8-9,11H2 |
| InChIKey | XAJQFPIVWYQHKW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|