C11H18N2S — CID 61151130
N-(cyclopropylmethyl)-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine (PubChem CID 61151130) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N-(cyclopropylmethyl)-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 61151130 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-(thiophen-2-ylmethyl)ethane-1,2-diamine |
| SMILES | c1csc(CNCCNCC2CC2)c1 |
| InChI | InChI=1S/C11H18N2S/c1-2-11(14-7-1)9-13-6-5-12-8-10-3-4-10/h1-2,7,10,12-13H,3-6,8-9H2 |
| InChIKey | PQCITBKMWJITHG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|