C10H18ClN2OS- — CID 53350890
1-[2-(thiophen-2-ylmethylamino)ethylamino]propan-2-ol chloride (PubChem CID 53350890) has the molecular formula C10H18ClN2OS- and a molecular weight of 249.79 g/mol. Its IUPAC name is 1-[2-(thiophen-2-ylmethylamino)ethylamino]propan-2-ol chloride.
| Compound Name | 1-[2-(thiophen-2-ylmethylamino)ethylamino]propan-2-ol chloride |
|---|---|
| PubChem CID | 53350890 |
| Molecular Formula | C10H18ClN2OS- |
| Molecular Weight | 249.79 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 1-[2-(thiophen-2-ylmethylamino)ethylamino]propan-2-ol chloride |
| SMILES | CC(O)CNCCNCc1cccs1.[Cl-] |
| InChI | InChI=1S/C10H18N2OS.ClH/c1-9(13)7-11-4-5-12-8-10-3-2-6-14-10;/h2-3,6,9,11-13H,4-5,7-8H2,1H3;1H/p-1 |
| InChIKey | HQHYRJKRBQYKCK-UHFFFAOYSA-M |
| XLogP | -2.19 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.79 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|