C9H15NOS — CID 96500236
(2R)-4-(thiophen-2-ylmethylamino)butan-2-ol (PubChem CID 96500236) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is (2R)-4-(thiophen-2-ylmethylamino)butan-2-ol.
| Compound Name | (2R)-4-(thiophen-2-ylmethylamino)butan-2-ol |
|---|---|
| PubChem CID | 96500236 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | (2R)-4-(thiophen-2-ylmethylamino)butan-2-ol |
| SMILES | C[C@@H](O)CCNCc1cccs1 |
| InChI | InChI=1S/C9H15NOS/c1-8(11)4-5-10-7-9-3-2-6-12-9/h2-3,6,8,10-11H,4-5,7H2,1H3/t8-/m1/s1 |
| InChIKey | FPNGPGNOKVBXTR-MRVPVSSYSA-N |
| XLogP | 1.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|