C8H14N2S — CID 61150337
1-N-(thiophen-2-ylmethyl)propane-1,2-diamine (PubChem CID 61150337) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-N-(thiophen-2-ylmethyl)propane-1,2-diamine.
| Compound Name | 1-N-(thiophen-2-ylmethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 61150337 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-N-(thiophen-2-ylmethyl)propane-1,2-diamine |
| SMILES | CC(N)CNCc1cccs1 |
| InChI | InChI=1S/C8H14N2S/c1-7(9)5-10-6-8-3-2-4-11-8/h2-4,7,10H,5-6,9H2,1H3 |
| InChIKey | MZQBOEIRRSYUNU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |