C14H17NO2S2 — CID 106512291
2-(benzenesulfonyl)-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 106512291) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 2-(benzenesulfonyl)-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 106512291 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-(benzenesulfonyl)-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1cccs1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H17NO2S2/c1-12(10-15-11-13-6-5-9-18-13)19(16,17)14-7-3-2-4-8-14/h2-9,12,15H,10-11H2,1H3 |
| InChIKey | YDECKOFKBIRGAA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |