C19H28N2O3S — CID 8621370
(2R)-1-[2-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol (PubChem CID 8621370) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is (2R)-1-[2-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol.
| Compound Name | (2R)-1-[2-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 8621370 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2R)-1-[2-[[3-ethoxy-4-(thiophen-2-ylmethoxy)phenyl]methylamino]ethylamino]propan-2-ol |
| SMILES | CCOc1cc(CNCCNC[C@@H](C)O)ccc1OCc1cccs1 |
| InChI | InChI=1S/C19H28N2O3S/c1-3-23-19-11-16(13-21-9-8-20-12-15(2)22)6-7-18(19)24-14-17-5-4-10-25-17/h4-7,10-11,15,20-22H,3,8-9,12-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | VHYPEXVZJJLILG-OAHLLOKOSA-N |
| XLogP | 2.79 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|