C14H23BrN2O2 — CID 17159735
1-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethylamino]propan-2-ol (PubChem CID 17159735) has the molecular formula C14H23BrN2O2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethylamino]propan-2-ol.
| Compound Name | 1-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 17159735 |
| Molecular Formula | C14H23BrN2O2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-[2-[(3-bromo-4-ethoxyphenyl)methylamino]ethylamino]propan-2-ol |
| SMILES | CCOc1ccc(CNCCNCC(C)O)cc1Br |
| InChI | InChI=1S/C14H23BrN2O2/c1-3-19-14-5-4-12(8-13(14)15)10-17-7-6-16-9-11(2)18/h4-5,8,11,16-18H,3,6-7,9-10H2,1-2H3 |
| InChIKey | JJRBNTSZRNVSJQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|