C22H34Cl2N2O3 — CID 17055015
1-[2-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride (PubChem CID 17055015) has the molecular formula C22H34Cl2N2O3 and a molecular weight of 445.43 g/mol. Its IUPAC name is 1-[2-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride.
| Compound Name | 1-[2-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
|---|---|
| PubChem CID | 17055015 |
| Molecular Formula | C22H34Cl2N2O3 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-[2-[[3-ethoxy-4-[(4-methylphenyl)methoxy]phenyl]methylamino]ethylamino]propan-2-ol;dihydrochloride |
| SMILES | CCOc1cc(CNCCNCC(C)O)ccc1OCc1ccc(C)cc1.Cl.Cl |
| InChI | InChI=1S/C22H32N2O3.2ClH/c1-4-26-22-13-20(15-24-12-11-23-14-18(3)25)9-10-21(22)27-16-19-7-5-17(2)6-8-19;;/h5-10,13,18,23-25H,4,11-12,14-16H2,1-3H3;2*1H |
| InChIKey | FPBFSLZFYIOSJS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|