C19H24ClNO3 — CID 51997058
(2S)-1-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]propan-2-ol (PubChem CID 51997058) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is (2S)-1-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]propan-2-ol.
| Compound Name | (2S)-1-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 51997058 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | (2S)-1-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]propan-2-ol |
| SMILES | CCOc1cc(CNC[C@H](C)O)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H24ClNO3/c1-3-23-19-10-15(12-21-11-14(2)22)7-8-18(19)24-13-16-5-4-6-17(20)9-16/h4-10,14,21-22H,3,11-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | WRXKIXWPBKVOQM-AWEZNQCLSA-N |
| XLogP | 3.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |