C24H26ClNO3 — CID 51992940
(1R)-2-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-1-phenylethanol (PubChem CID 51992940) has the molecular formula C24H26ClNO3 and a molecular weight of 411.93 g/mol. Its IUPAC name is (1R)-2-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-1-phenylethanol.
| Compound Name | (1R)-2-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-1-phenylethanol |
|---|---|
| PubChem CID | 51992940 |
| Molecular Formula | C24H26ClNO3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (1R)-2-[[4-[(3-chlorophenyl)methoxy]-3-ethoxyphenyl]methylamino]-1-phenylethanol |
| SMILES | CCOc1cc(CNC[C@H](O)c2ccccc2)ccc1OCc1cccc(Cl)c1 |
| InChI | InChI=1S/C24H26ClNO3/c1-2-28-24-14-18(15-26-16-22(27)20-8-4-3-5-9-20)11-12-23(24)29-17-19-7-6-10-21(25)13-19/h3-14,22,26-27H,2,15-17H2,1H3/t22-/m0/s1 |
| InChIKey | ANMAPMUAEHXTLS-QFIPXVFZSA-N |
| XLogP | 5.14 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |