C16H27ClN2O3 — CID 28700914
(2S)-1-[2-[(3-chloro-4,5-diethoxyphenyl)methylamino]ethylamino]propan-2-ol (PubChem CID 28700914) has the molecular formula C16H27ClN2O3 and a molecular weight of 330.86 g/mol. Its IUPAC name is (2S)-1-[2-[(3-chloro-4,5-diethoxyphenyl)methylamino]ethylamino]propan-2-ol.
| Compound Name | (2S)-1-[2-[(3-chloro-4,5-diethoxyphenyl)methylamino]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 28700914 |
| Molecular Formula | C16H27ClN2O3 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (2S)-1-[2-[(3-chloro-4,5-diethoxyphenyl)methylamino]ethylamino]propan-2-ol |
| SMILES | CCOc1cc(CNCCNC[C@H](C)O)cc(Cl)c1OCC |
| InChI | InChI=1S/C16H27ClN2O3/c1-4-21-15-9-13(8-14(17)16(15)22-5-2)11-19-7-6-18-10-12(3)20/h8-9,12,18-20H,4-7,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | JLYGXLAULXYHEN-LBPRGKRZSA-N |
| XLogP | 2.20 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|