C11H16N2OS — CID 75525535
N-[2-(thiophen-2-ylmethylamino)ethyl]cyclopropanecarboxamide (PubChem CID 75525535) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is N-[2-(thiophen-2-ylmethylamino)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(thiophen-2-ylmethylamino)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 75525535 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | N-[2-(thiophen-2-ylmethylamino)ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNCc1cccs1)C1CC1 |
| InChI | InChI=1S/C11H16N2OS/c14-11(9-3-4-9)13-6-5-12-8-10-2-1-7-15-10/h1-2,7,9,12H,3-6,8H2,(H,13,14) |
| InChIKey | CFFCBPHNKUSQCL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|