C13H18F3NS — CID 79072850
N-(thiophen-2-ylmethyl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine (PubChem CID 79072850) has the molecular formula C13H18F3NS and a molecular weight of 277.35 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine.
| Compound Name | N-(thiophen-2-ylmethyl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 79072850 |
| Molecular Formula | C13H18F3NS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-1-[4-(trifluoromethyl)cyclohexyl]methanamine |
| SMILES | FC(F)(F)C1CCC(CNCc2cccs2)CC1 |
| InChI | InChI=1S/C13H18F3NS/c14-13(15,16)11-5-3-10(4-6-11)8-17-9-12-2-1-7-18-12/h1-2,7,10-11,17H,3-6,8-9H2 |
| InChIKey | VEEIIDBVMWVKRU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |