C14H16ClN3S — CID 6498234
N-[(3-chlorophenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine (PubChem CID 6498234) has the molecular formula C14H16ClN3S and a molecular weight of 293.82 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine.
| Compound Name | N-[(3-chlorophenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 6498234 |
| Molecular Formula | C14H16ClN3S |
| Molecular Weight | 293.82 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine |
| SMILES | Clc1cccc(CNCCCSc2ncccn2)c1 |
| InChI | InChI=1S/C14H16ClN3S/c15-13-5-1-4-12(10-13)11-16-6-3-9-19-14-17-7-2-8-18-14/h1-2,4-5,7-8,10,16H,3,6,9,11H2 |
| InChIKey | LROVPFWBJKGKGM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.82 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|