C15H18Cl2N3OS- — CID 53351922
N-[(5-chloro-2-methoxyphenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine chloride (PubChem CID 53351922) has the molecular formula C15H18Cl2N3OS- and a molecular weight of 359.30 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxyphenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine chloride.
| Compound Name | N-[(5-chloro-2-methoxyphenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine chloride |
|---|---|
| PubChem CID | 53351922 |
| Molecular Formula | C15H18Cl2N3OS- |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[(5-chloro-2-methoxyphenyl)methyl]-3-pyrimidin-2-ylsulfanylpropan-1-amine chloride |
| SMILES | COc1ccc(Cl)cc1CNCCCSc1ncccn1.[Cl-] |
| InChI | InChI=1S/C15H18ClN3OS.ClH/c1-20-14-5-4-13(16)10-12(14)11-17-6-3-9-21-15-18-7-2-8-19-15;/h2,4-5,7-8,10,17H,3,6,9,11H2,1H3;1H/p-1 |
| InChIKey | HSCORSKXKUXXSQ-UHFFFAOYSA-M |
| XLogP | 0.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|