C14H18ClNOS — CID 17290088
N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride (PubChem CID 17290088) has the molecular formula C14H18ClNOS and a molecular weight of 283.82 g/mol. Its IUPAC name is N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride.
| Compound Name | N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17290088 |
| Molecular Formula | C14H18ClNOS |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]ethanamine;hydrochloride |
| SMILES | CCNCc1ccc(OCc2cccs2)cc1.Cl |
| InChI | InChI=1S/C14H17NOS.ClH/c1-2-15-10-12-5-7-13(8-6-12)16-11-14-4-3-9-17-14;/h3-9,15H,2,10-11H2,1H3;1H |
| InChIKey | DHSIIDGJQXHPOL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |