C20H28ClNOS — CID 17331809
N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclooctanamine;hydrochloride (PubChem CID 17331809) has the molecular formula C20H28ClNOS and a molecular weight of 365.97 g/mol. Its IUPAC name is N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclooctanamine;hydrochloride.
| Compound Name | N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclooctanamine;hydrochloride |
|---|---|
| PubChem CID | 17331809 |
| Molecular Formula | C20H28ClNOS |
| Molecular Weight | 365.97 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cyclooctanamine;hydrochloride |
| SMILES | Cl.c1csc(COc2ccc(CNC3CCCCCCC3)cc2)c1 |
| InChI | InChI=1S/C20H27NOS.ClH/c1-2-4-7-18(8-5-3-1)21-15-17-10-12-19(13-11-17)22-16-20-9-6-14-23-20;/h6,9-14,18,21H,1-5,7-8,15-16H2;1H |
| InChIKey | NMIHGDTZRSRZKV-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.97 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |