C19H26ClNOS — CID 17331804
N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cycloheptanamine;hydrochloride (PubChem CID 17331804) has the molecular formula C19H26ClNOS and a molecular weight of 351.94 g/mol. Its IUPAC name is N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cycloheptanamine;hydrochloride.
| Compound Name | N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cycloheptanamine;hydrochloride |
|---|---|
| PubChem CID | 17331804 |
| Molecular Formula | C19H26ClNOS |
| Molecular Weight | 351.94 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[[4-(thiophen-2-ylmethoxy)phenyl]methyl]cycloheptanamine;hydrochloride |
| SMILES | Cl.c1csc(COc2ccc(CNC3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C19H25NOS.ClH/c1-2-4-7-17(6-3-1)20-14-16-9-11-18(12-10-16)21-15-19-8-5-13-22-19;/h5,8-13,17,20H,1-4,6-7,14-15H2;1H |
| InChIKey | SALLPZOPNXZENL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.94 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |