C10H16N8OS — CID 91771033
N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 91771033) has the molecular formula C10H16N8OS and a molecular weight of 296.36 g/mol. Its IUPAC name is N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 91771033 |
| Molecular Formula | C10H16N8OS |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | N-[2-(1-methyltetrazol-5-yl)sulfanylethyl]-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | Cn1nnnc1SCCNC(=O)CCCn1cncn1 |
| InChI | InChI=1S/C10H16N8OS/c1-17-10(14-15-16-17)20-6-4-12-9(19)3-2-5-18-8-11-7-13-18/h7-8H,2-6H2,1H3,(H,12,19) |
| InChIKey | YYAHXRGSPPDAOB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|