C11H14N6OS — CID 13203384
4-(1-methyltetrazol-5-yl)sulfanyl-N-pyridin-3-ylbutanamide (PubChem CID 13203384) has the molecular formula C11H14N6OS and a molecular weight of 278.34 g/mol. Its IUPAC name is 4-(1-methyltetrazol-5-yl)sulfanyl-N-pyridin-3-ylbutanamide.
| Compound Name | 4-(1-methyltetrazol-5-yl)sulfanyl-N-pyridin-3-ylbutanamide |
|---|---|
| PubChem CID | 13203384 |
| Molecular Formula | C11H14N6OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-(1-methyltetrazol-5-yl)sulfanyl-N-pyridin-3-ylbutanamide |
| SMILES | Cn1nnnc1SCCCC(=O)Nc1cccnc1 |
| InChI | InChI=1S/C11H14N6OS/c1-17-11(14-15-16-17)19-7-3-5-10(18)13-9-4-2-6-12-8-9/h2,4,6,8H,3,5,7H2,1H3,(H,13,18) |
| InChIKey | YLNRKZFRDOVIIZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|