C12H22N4O2S — CID 167843334
N-(2-tert-butylsulfinylethyl)-4-(1,2,4-triazol-1-yl)butanamide (PubChem CID 167843334) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-(2-tert-butylsulfinylethyl)-4-(1,2,4-triazol-1-yl)butanamide.
| Compound Name | N-(2-tert-butylsulfinylethyl)-4-(1,2,4-triazol-1-yl)butanamide |
|---|---|
| PubChem CID | 167843334 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-(2-tert-butylsulfinylethyl)-4-(1,2,4-triazol-1-yl)butanamide |
| SMILES | CC(C)(C)S(=O)CCNC(=O)CCCn1cncn1 |
| InChI | InChI=1S/C12H22N4O2S/c1-12(2,3)19(18)8-6-14-11(17)5-4-7-16-10-13-9-15-16/h9-10H,4-8H2,1-3H3,(H,14,17) |
| InChIKey | ZKUHLFAOSDTFHQ-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |