C12H15N5O — CID 110500390
N-(2,5-dimethylphenyl)-2-(1-methyltetrazol-5-yl)acetamide (PubChem CID 110500390) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-2-(1-methyltetrazol-5-yl)acetamide.
| Compound Name | N-(2,5-dimethylphenyl)-2-(1-methyltetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110500390 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-(2,5-dimethylphenyl)-2-(1-methyltetrazol-5-yl)acetamide |
| SMILES | Cc1ccc(C)c(NC(=O)Cc2nnnn2C)c1 |
| InChI | InChI=1S/C12H15N5O/c1-8-4-5-9(2)10(6-8)13-12(18)7-11-14-15-16-17(11)3/h4-6H,7H2,1-3H3,(H,13,18) |
| InChIKey | OAZZITMMSIZGTF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |