C11H10F3N5O — CID 110500529
2-(1-methyltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 110500529) has the molecular formula C11H10F3N5O and a molecular weight of 285.23 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 110500529 |
| Molecular Formula | C11H10F3N5O |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)-N-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cn1nnnc1CC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10F3N5O/c1-19-9(16-17-18-19)6-10(20)15-8-4-2-7(3-5-8)11(12,13)14/h2-5H,6H2,1H3,(H,15,20) |
| InChIKey | PALPKDJFDBTSND-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |