C8H8ClN7O — CID 110500574
N-(6-chloropyridazin-3-yl)-2-(1-methyltetrazol-5-yl)acetamide (PubChem CID 110500574) has the molecular formula C8H8ClN7O and a molecular weight of 253.65 g/mol. Its IUPAC name is N-(6-chloropyridazin-3-yl)-2-(1-methyltetrazol-5-yl)acetamide.
| Compound Name | N-(6-chloropyridazin-3-yl)-2-(1-methyltetrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 110500574 |
| Molecular Formula | C8H8ClN7O |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | N-(6-chloropyridazin-3-yl)-2-(1-methyltetrazol-5-yl)acetamide |
| SMILES | Cn1nnnc1CC(=O)Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C8H8ClN7O/c1-16-7(13-14-15-16)4-8(17)10-6-3-2-5(9)11-12-6/h2-3H,4H2,1H3,(H,10,12,17) |
| InChIKey | KLUVLQDKLVWYJA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |