C15H19N5O4S — CID 55979185
methyl 2-[3-methyl-4-[3-(1-methyltetrazol-5-yl)sulfanylpropanoylamino]phenoxy]acetate (PubChem CID 55979185) has the molecular formula C15H19N5O4S and a molecular weight of 365.42 g/mol. Its IUPAC name is methyl 2-[3-methyl-4-[3-(1-methyltetrazol-5-yl)sulfanylpropanoylamino]phenoxy]acetate.
| Compound Name | methyl 2-[3-methyl-4-[3-(1-methyltetrazol-5-yl)sulfanylpropanoylamino]phenoxy]acetate |
|---|---|
| PubChem CID | 55979185 |
| Molecular Formula | C15H19N5O4S |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | methyl 2-[3-methyl-4-[3-(1-methyltetrazol-5-yl)sulfanylpropanoylamino]phenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)CCSc2nnnn2C)c(C)c1 |
| InChI | InChI=1S/C15H19N5O4S/c1-10-8-11(24-9-14(22)23-3)4-5-12(10)16-13(21)6-7-25-15-17-18-19-20(15)2/h4-5,8H,6-7,9H2,1-3H3,(H,16,21) |
| InChIKey | XRVTWEBMUOTPMO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |