C21H24N6O3S — CID 42023980
N-[2-(2,4-dimethylphenoxy)ethyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide (PubChem CID 42023980) has the molecular formula C21H24N6O3S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[2-(2,4-dimethylphenoxy)ethyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-[2-(2,4-dimethylphenoxy)ethyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 42023980 |
| Molecular Formula | C21H24N6O3S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | N-[2-(2,4-dimethylphenoxy)ethyl]-4-[[2-(1-methyltetrazol-5-yl)sulfanylacetyl]amino]benzamide |
| SMILES | Cc1ccc(OCCNC(=O)c2ccc(NC(=O)CSc3nnnn3C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H24N6O3S/c1-14-4-9-18(15(2)12-14)30-11-10-22-20(29)16-5-7-17(8-6-16)23-19(28)13-31-21-24-25-26-27(21)3/h4-9,12H,10-11,13H2,1-3H3,(H,22,29)(H,23,28) |
| InChIKey | PPFAHCZAIHKDMH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|