C20H22FN5O2S — CID 8580736
2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide (PubChem CID 8580736) has the molecular formula C20H22FN5O2S and a molecular weight of 415.49 g/mol. Its IUPAC name is 2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide.
| Compound Name | 2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 8580736 |
| Molecular Formula | C20H22FN5O2S |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-[[4-amino-5-(4-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-[2-(2,4-dimethylphenoxy)ethyl]acetamide |
| SMILES | Cc1ccc(OCCNC(=O)CSc2nnc(-c3ccc(F)cc3)n2N)c(C)c1 |
| InChI | InChI=1S/C20H22FN5O2S/c1-13-3-8-17(14(2)11-13)28-10-9-23-18(27)12-29-20-25-24-19(26(20)22)15-4-6-16(21)7-5-15/h3-8,11H,9-10,12,22H2,1-2H3,(H,23,27) |
| InChIKey | NRZBUHZXDSAGJN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|