C17H25N5O2S — CID 9062585
2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide (PubChem CID 9062585) has the molecular formula C17H25N5O2S and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide.
| Compound Name | 2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide |
|---|---|
| PubChem CID | 9062585 |
| Molecular Formula | C17H25N5O2S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-butylacetamide |
| SMILES | CCCCNC(=O)CSc1nnc(COc2ccc(C)cc2C)n1N |
| InChI | InChI=1S/C17H25N5O2S/c1-4-5-8-19-16(23)11-25-17-21-20-15(22(17)18)10-24-14-7-6-12(2)9-13(14)3/h6-7,9H,4-5,8,10-11,18H2,1-3H3,(H,19,23) |
| InChIKey | UVZCTNAZAATBCQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|