C21H33N5O2S — CID 55399161
2-[[4-amino-5-[(4-tert-butylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide (PubChem CID 55399161) has the molecular formula C21H33N5O2S and a molecular weight of 419.60 g/mol. Its IUPAC name is 2-[[4-amino-5-[(4-tert-butylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide.
| Compound Name | 2-[[4-amino-5-[(4-tert-butylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
|---|---|
| PubChem CID | 55399161 |
| Molecular Formula | C21H33N5O2S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 2-[[4-amino-5-[(4-tert-butylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-hexylacetamide |
| SMILES | CCCCCCNC(=O)CSc1nnc(COc2ccc(C(C)(C)C)cc2)n1N |
| InChI | InChI=1S/C21H33N5O2S/c1-5-6-7-8-13-23-19(27)15-29-20-25-24-18(26(20)22)14-28-17-11-9-16(10-12-17)21(2,3)4/h9-12H,5-8,13-15,22H2,1-4H3,(H,23,27) |
| InChIKey | WMVJNZUBRMJXEV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|