C16H20FN5O4S — CID 55442783
methyl 4-[[2-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate (PubChem CID 55442783) has the molecular formula C16H20FN5O4S and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 4-[[2-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 55442783 |
| Molecular Formula | C16H20FN5O4S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | methyl 4-[[2-[[4-amino-5-[(4-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)CSc1nnc(COc2ccc(F)cc2)n1N |
| InChI | InChI=1S/C16H20FN5O4S/c1-25-15(24)3-2-8-19-14(23)10-27-16-21-20-13(22(16)18)9-26-12-6-4-11(17)5-7-12/h4-7H,2-3,8-10,18H2,1H3,(H,19,23) |
| InChIKey | WZITVBWAGYMEHM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|