C17H24N6O4S — CID 55422700
2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(butylcarbamoyl)acetamide (PubChem CID 55422700) has the molecular formula C17H24N6O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(butylcarbamoyl)acetamide.
| Compound Name | 2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55422700 |
| Molecular Formula | C17H24N6O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(butylcarbamoyl)acetamide |
| SMILES | CCCCNC(=O)NC(=O)CSc1nnc(COc2cccc(OC)c2)n1N |
| InChI | InChI=1S/C17H24N6O4S/c1-3-4-8-19-16(25)20-15(24)11-28-17-22-21-14(23(17)18)10-27-13-7-5-6-12(9-13)26-2/h5-7,9H,3-4,8,10-11,18H2,1-2H3,(H2,19,20,24,25) |
| InChIKey | XPCCTDOUAUIOEK-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|