C19H19N7O6S — CID 55380068
N'-[2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 55380068) has the molecular formula C19H19N7O6S and a molecular weight of 473.47 g/mol. Its IUPAC name is N'-[2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 55380068 |
| Molecular Formula | C19H19N7O6S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N'-[2-[[4-amino-5-[(3-methoxyphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | COc1cccc(OCc2nnc(SCC(=O)NNC(=O)c3cccc([N+](=O)[O-])c3)n2N)c1 |
| InChI | InChI=1S/C19H19N7O6S/c1-31-14-6-3-7-15(9-14)32-10-16-21-24-19(25(16)20)33-11-17(27)22-23-18(28)12-4-2-5-13(8-12)26(29)30/h2-9H,10-11,20H2,1H3,(H,22,27)(H,23,28) |
| InChIKey | LOQXOJXBGQPNRK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|