C21H31N5O2S — CID 11909637
2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide (PubChem CID 11909637) has the molecular formula C21H31N5O2S and a molecular weight of 417.58 g/mol. Its IUPAC name is 2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide.
| Compound Name | 2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 11909637 |
| Molecular Formula | C21H31N5O2S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]acetamide |
| SMILES | Cc1ccc(OCc2nnc(SCC(=O)N[C@H]3CCC[C@@H](C)[C@@H]3C)n2N)c(C)c1 |
| InChI | InChI=1S/C21H31N5O2S/c1-13-8-9-18(15(3)10-13)28-11-19-24-25-21(26(19)22)29-12-20(27)23-17-7-5-6-14(2)16(17)4/h8-10,14,16-17H,5-7,11-12,22H2,1-4H3,(H,23,27)/t14-,16+,17+/m1/s1 |
| InChIKey | FFFBMWXSIVORAM-PVAVHDDUSA-N |
| XLogP | 3.22 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |