C22H31N5O2S — CID 8627914
1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 8627914) has the molecular formula C22H31N5O2S and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 8627914 |
| Molecular Formula | C22H31N5O2S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[(4aS,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-[[4-amino-5-[(2,4-dimethylphenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | Cc1ccc(OCc2nnc(SCC(=O)N3CCC[C@@H]4CCCC[C@H]43)n2N)c(C)c1 |
| InChI | InChI=1S/C22H31N5O2S/c1-15-9-10-19(16(2)12-15)29-13-20-24-25-22(27(20)23)30-14-21(28)26-11-5-7-17-6-3-4-8-18(17)26/h9-10,12,17-18H,3-8,11,13-14,23H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | LXSPQJPWSNKFLW-ZWKOTPCHSA-N |
| XLogP | 3.46 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |