C20H27N5OS — CID 78754864
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylethanone (PubChem CID 78754864) has the molecular formula C20H27N5OS and a molecular weight of 385.54 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylethanone |
|---|---|
| PubChem CID | 78754864 |
| Molecular Formula | C20H27N5OS |
| Molecular Weight | 385.54 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylethanone |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)N2CCCC3CCCCC32)c(C)c1 |
| InChI | InChI=1S/C20H27N5OS/c1-14-9-10-17(15(2)12-14)25-20(21-22-23-25)27-13-19(26)24-11-5-7-16-6-3-4-8-18(16)24/h9-10,12,16,18H,3-8,11,13H2,1-2H3 |
| InChIKey | DREVPHARAWOKKJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.54 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |