C17H22N4O2S — CID 858448
cyclohexyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 858448) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is cyclohexyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | cyclohexyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 858448 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | cyclohexyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | Cc1ccc(-n2nnnc2SCC(=O)OC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-12-8-9-15(13(2)10-12)21-17(18-19-20-21)24-11-16(22)23-14-6-4-3-5-7-14/h8-10,14H,3-7,11H2,1-2H3 |
| InChIKey | HLGOLPSOMJTKOB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |