C15H20N4O2S — CID 84602659
butyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 84602659) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is butyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | butyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 84602659 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | butyl 2-[1-(2,4-dimethylphenyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | CCCCOC(=O)CSc1nnnn1-c1ccc(C)cc1C |
| InChI | InChI=1S/C15H20N4O2S/c1-4-5-8-21-14(20)10-22-15-16-17-18-19(15)13-7-6-11(2)9-12(13)3/h6-7,9H,4-5,8,10H2,1-3H3 |
| InChIKey | XGGXODCYBGNRPV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|