C12H14ClN5OS — CID 26428369
N-(2-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide (PubChem CID 26428369) has the molecular formula C12H14ClN5OS and a molecular weight of 311.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 26428369 |
| Molecular Formula | C12H14ClN5OS |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | N-(2-chlorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide |
| SMILES | CC(C)n1nnnc1SCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C12H14ClN5OS/c1-8(2)18-12(15-16-17-18)20-7-11(19)14-10-6-4-3-5-9(10)13/h3-6,8H,7H2,1-2H3,(H,14,19) |
| InChIKey | QIYSDIPFMHZJOC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |