C12H13ClFN5OS — CID 17413017
N-(5-chloro-2-fluorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide (PubChem CID 17413017) has the molecular formula C12H13ClFN5OS and a molecular weight of 329.79 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 17413017 |
| Molecular Formula | C12H13ClFN5OS |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide |
| SMILES | CC(C)n1nnnc1SCC(=O)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C12H13ClFN5OS/c1-7(2)19-12(16-17-18-19)21-6-11(20)15-10-5-8(13)3-4-9(10)14/h3-5,7H,6H2,1-2H3,(H,15,20) |
| InChIKey | NYJQEEQLVIYJDY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |