C13H16N6O3S — CID 27139065
N-(2-methyl-5-nitrophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide (PubChem CID 27139065) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is N-(2-methyl-5-nitrophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2-methyl-5-nitrophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 27139065 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N-(2-methyl-5-nitrophenyl)-2-(1-propan-2-yltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nnnn1C(C)C |
| InChI | InChI=1S/C13H16N6O3S/c1-8(2)18-13(15-16-17-18)23-7-12(20)14-11-6-10(19(21)22)5-4-9(11)3/h4-6,8H,7H2,1-3H3,(H,14,20) |
| InChIKey | TWPAPYUSCRIWHB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|