C17H20N6O3S — CID 1263160
2-[1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]tetrazol-5-yl]sulfanyl-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 1263160) has the molecular formula C17H20N6O3S and a molecular weight of 388.45 g/mol. Its IUPAC name is 2-[1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]tetrazol-5-yl]sulfanyl-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]tetrazol-5-yl]sulfanyl-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1263160 |
| Molecular Formula | C17H20N6O3S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-[1-[(1S,2S,4R)-2-bicyclo[2.2.1]heptanyl]tetrazol-5-yl]sulfanyl-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)CSc1nnnn1[C@H]1C[C@@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C17H20N6O3S/c1-10-2-5-13(23(25)26)8-14(10)18-16(24)9-27-17-19-20-21-22(17)15-7-11-3-4-12(15)6-11/h2,5,8,11-12,15H,3-4,6-7,9H2,1H3,(H,18,24)/t11-,12+,15+/m1/s1 |
| InChIKey | HGKLHELLRARIHK-XUJVJEKNSA-N |
| XLogP | 2.98 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|