C14H17N5O3S — CID 7675488
N-(2-methyl-4-nitrophenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide (PubChem CID 7675488) has the molecular formula C14H17N5O3S and a molecular weight of 335.39 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide.
| Compound Name | N-(2-methyl-4-nitrophenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 7675488 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-2-[(4-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CSc1nncn1C(C)C |
| InChI | InChI=1S/C14H17N5O3S/c1-9(2)18-8-15-17-14(18)23-7-13(20)16-12-5-4-11(19(21)22)6-10(12)3/h4-6,8-9H,7H2,1-3H3,(H,16,20) |
| InChIKey | LNXICXKKOVPPMF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|