C16H22N6O3S2 — CID 55972416
3-(1-methyltetrazol-5-yl)sulfanyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide (PubChem CID 55972416) has the molecular formula C16H22N6O3S2 and a molecular weight of 410.53 g/mol. Its IUPAC name is 3-(1-methyltetrazol-5-yl)sulfanyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide.
| Compound Name | 3-(1-methyltetrazol-5-yl)sulfanyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide |
|---|---|
| PubChem CID | 55972416 |
| Molecular Formula | C16H22N6O3S2 |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-(1-methyltetrazol-5-yl)sulfanyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]propanamide |
| SMILES | Cn1nnnc1SCCC(=O)NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C16H22N6O3S2/c1-21-16(18-19-20-21)26-11-8-15(23)17-12-13-4-6-14(7-5-13)27(24,25)22-9-2-3-10-22/h4-7H,2-3,8-12H2,1H3,(H,17,23) |
| InChIKey | IUOFPSUDFOXTIQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |