C15H19ClN6O3S2 — CID 4086709
N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 4086709) has the molecular formula C15H19ClN6O3S2 and a molecular weight of 430.94 g/mol. Its IUPAC name is N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4086709 |
| Molecular Formula | C15H19ClN6O3S2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | N-(2-chloro-5-piperidin-1-ylsulfonylphenyl)-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nnnc1SCC(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C15H19ClN6O3S2/c1-21-15(18-19-20-21)26-10-14(23)17-13-9-11(5-6-12(13)16)27(24,25)22-7-3-2-4-8-22/h5-6,9H,2-4,7-8,10H2,1H3,(H,17,23) |
| InChIKey | XFDRBAFEFRITAT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |