C14H14ClN7OS — CID 8007009
N-[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide (PubChem CID 8007009) has the molecular formula C14H14ClN7OS and a molecular weight of 363.83 g/mol. Its IUPAC name is N-[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 8007009 |
| Molecular Formula | C14H14ClN7OS |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-[3-(4-chlorophenyl)-1-methylpyrazol-5-yl]-2-(1-methyltetrazol-5-yl)sulfanylacetamide |
| SMILES | Cn1nc(-c2ccc(Cl)cc2)cc1NC(=O)CSc1nnnn1C |
| InChI | InChI=1S/C14H14ClN7OS/c1-21-12(7-11(18-21)9-3-5-10(15)6-4-9)16-13(23)8-24-14-17-19-20-22(14)2/h3-7H,8H2,1-2H3,(H,16,23) |
| InChIKey | ROEIFWQXMPGXLT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |