C21H27ClN6OS — CID 24570262
2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylpyrazol-3-yl)acetamide (PubChem CID 24570262) has the molecular formula C21H27ClN6OS and a molecular weight of 447.01 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylpyrazol-3-yl)acetamide.
| Compound Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylpyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 24570262 |
| Molecular Formula | C21H27ClN6OS |
| Molecular Weight | 447.01 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-4-hexyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2,5-dimethylpyrazol-3-yl)acetamide |
| SMILES | CCCCCCn1c(SCC(=O)Nc2cc(C)nn2C)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClN6OS/c1-4-5-6-7-12-28-20(16-8-10-17(22)11-9-16)24-25-21(28)30-14-19(29)23-18-13-15(2)26-27(18)3/h8-11,13H,4-7,12,14H2,1-3H3,(H,23,29) |
| InChIKey | FUYXJWYLCQLKQX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.01 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|